C19H20ClNO4 — CID 27555148
ethyl 1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-4-carboxylate (PubChem CID 27555148) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is ethyl 1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 27555148 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl 1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(-c3ccccc3Cl)o2)CC1 |
| InChI | InChI=1S/C19H20ClNO4/c1-2-24-19(23)13-9-11-21(12-10-13)18(22)17-8-7-16(25-17)14-5-3-4-6-15(14)20/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | VCJZSJIFNHDQGP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |