C17H16ClN5O2 — CID 154801117
[5-(2-chlorophenyl)furan-2-yl]-[3-(2H-tetrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 154801117) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is [5-(2-chlorophenyl)furan-2-yl]-[3-(2H-tetrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | [5-(2-chlorophenyl)furan-2-yl]-[3-(2H-tetrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154801117 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [5-(2-chlorophenyl)furan-2-yl]-[3-(2H-tetrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2Cl)o1)N1CCCC(c2nn[nH]n2)C1 |
| InChI | InChI=1S/C17H16ClN5O2/c18-13-6-2-1-5-12(13)14-7-8-15(25-14)17(24)23-9-3-4-11(10-23)16-19-21-22-20-16/h1-2,5-8,11H,3-4,9-10H2,(H,19,20,21,22) |
| InChIKey | QDJODMXWGXEFGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |