C18H19ClN2O3 — CID 9086350
5-(2-chlorophenyl)-N'-(cyclohexanecarbonyl)furan-2-carbohydrazide (PubChem CID 9086350) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N'-(cyclohexanecarbonyl)furan-2-carbohydrazide.
| Compound Name | 5-(2-chlorophenyl)-N'-(cyclohexanecarbonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9086350 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-(2-chlorophenyl)-N'-(cyclohexanecarbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCC1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H19ClN2O3/c19-14-9-5-4-8-13(14)15-10-11-16(24-15)18(23)21-20-17(22)12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7H2,(H,20,22)(H,21,23) |
| InChIKey | OSSPOKDOZWBGTD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|