C13H12ClNO2 — CID 51188744
5-(2-chlorophenyl)-N-ethylfuran-2-carboxamide (PubChem CID 51188744) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-ethylfuran-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51188744 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5-(2-chlorophenyl)-N-ethylfuran-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C13H12ClNO2/c1-2-15-13(16)12-8-7-11(17-12)9-5-3-4-6-10(9)14/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | NCKIDNSWIZQQNT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |