C18H22ClNO2 — CID 16560702
5-(2-chlorophenyl)-N-(5-methylhexan-2-yl)furan-2-carboxamide (PubChem CID 16560702) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(5-methylhexan-2-yl)furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-(5-methylhexan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 16560702 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(5-methylhexan-2-yl)furan-2-carboxamide |
| SMILES | CC(C)CCC(C)NC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H22ClNO2/c1-12(2)8-9-13(3)20-18(21)17-11-10-16(22-17)14-6-4-5-7-15(14)19/h4-7,10-13H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | WNGLEEOYASWDQI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |