C14H13ClN2O4 — CID 166627868
(2R)-2-amino-3-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]propanoic acid (PubChem CID 166627868) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is (2R)-2-amino-3-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166627868 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2R)-2-amino-3-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]propanoic acid |
| SMILES | N[C@H](CNC(=O)c1ccc(-c2ccccc2Cl)o1)C(=O)O |
| InChI | InChI=1S/C14H13ClN2O4/c15-9-4-2-1-3-8(9)11-5-6-12(21-11)13(18)17-7-10(16)14(19)20/h1-6,10H,7,16H2,(H,17,18)(H,19,20)/t10-/m1/s1 |
| InChIKey | UENVVEZSVBSHPN-SNVBAGLBSA-N |
| XLogP | 1.74 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |