C15H15ClN2O3 — CID 56812733
N-(4-amino-4-oxobutyl)-5-(2-chlorophenyl)furan-2-carboxamide (PubChem CID 56812733) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-5-(2-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-5-(2-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 56812733 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-5-(2-chlorophenyl)furan-2-carboxamide |
| SMILES | NC(=O)CCCNC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H15ClN2O3/c16-11-5-2-1-4-10(11)12-7-8-13(21-12)15(20)18-9-3-6-14(17)19/h1-2,4-5,7-8H,3,6,9H2,(H2,17,19)(H,18,20) |
| InChIKey | RRIRLENMYHVJTP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|