C18H20ClNO4 — CID 134014900
methyl 6-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]hexanoate (PubChem CID 134014900) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is methyl 6-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 134014900 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 6-[[5-(2-chlorophenyl)furan-2-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H20ClNO4/c1-23-17(21)9-3-2-6-12-20-18(22)16-11-10-15(24-16)13-7-4-5-8-14(13)19/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3,(H,20,22) |
| InChIKey | RKDVQUJOGXBYBT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|