C17H19Cl2NO2 — CID 3764379
5-(2,4-dichlorophenyl)-N-hexylfuran-2-carboxamide (PubChem CID 3764379) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-hexylfuran-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-hexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 3764379 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-hexylfuran-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C17H19Cl2NO2/c1-2-3-4-5-10-20-17(21)16-9-8-15(22-16)13-7-6-12(18)11-14(13)19/h6-9,11H,2-5,10H2,1H3,(H,20,21) |
| InChIKey | FRVQZQBLVSGGBZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|