C15H17ClN2O3 — CID 91687739
5-(4-amino-2-chlorophenyl)-N-(3-methoxypropyl)furan-2-carboxamide (PubChem CID 91687739) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 5-(4-amino-2-chlorophenyl)-N-(3-methoxypropyl)furan-2-carboxamide.
| Compound Name | 5-(4-amino-2-chlorophenyl)-N-(3-methoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91687739 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-(4-amino-2-chlorophenyl)-N-(3-methoxypropyl)furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(-c2ccc(N)cc2Cl)o1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-20-8-2-7-18-15(19)14-6-5-13(21-14)11-4-3-10(17)9-12(11)16/h3-6,9H,2,7-8,17H2,1H3,(H,18,19) |
| InChIKey | SDKSAQWUXREXRT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|