C19H20N2O4S — CID 134014872
methyl 6-[[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]amino]hexanoate (PubChem CID 134014872) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl 6-[[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 134014872 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 6-[[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C19H20N2O4S/c1-24-17(22)9-3-2-6-12-20-18(23)14-10-11-15(25-14)19-21-13-7-4-5-8-16(13)26-19/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3,(H,20,23) |
| InChIKey | QDOQVWPDLTZYDU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|