C21H17N3O4S — CID 60572100
5-(1,3-benzothiazol-2-yl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]furan-2-carboxamide (PubChem CID 60572100) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60572100 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C21H17N3O4S/c25-15-7-3-1-5-13(15)19(26)22-11-12-23-20(27)16-9-10-17(28-16)21-24-14-6-2-4-8-18(14)29-21/h1-10,25H,11-12H2,(H,22,26)(H,23,27) |
| InChIKey | HALNKHKRNJIINO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|