C23H20N4O2S — CID 112767789
5-(1,3-benzothiazol-2-yl)-N-[3-(2-methylbenzimidazol-1-yl)propyl]furan-2-carboxamide (PubChem CID 112767789) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[3-(2-methylbenzimidazol-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[3-(2-methylbenzimidazol-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112767789 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[3-(2-methylbenzimidazol-1-yl)propyl]furan-2-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C23H20N4O2S/c1-15-25-16-7-2-4-9-18(16)27(15)14-6-13-24-22(28)19-11-12-20(29-19)23-26-17-8-3-5-10-21(17)30-23/h2-5,7-12H,6,13-14H2,1H3,(H,24,28) |
| InChIKey | IEORPGOKYYACAG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|