C14H13N3O2S — CID 9092602
5-(1,3-benzothiazol-2-yl)-N',N'-dimethylfuran-2-carbohydrazide (PubChem CID 9092602) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N',N'-dimethylfuran-2-carbohydrazide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N',N'-dimethylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9092602 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N',N'-dimethylfuran-2-carbohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C14H13N3O2S/c1-17(2)16-13(18)10-7-8-11(19-10)14-15-9-5-3-4-6-12(9)20-14/h3-8H,1-2H3,(H,16,18) |
| InChIKey | UEIJQCKYHSUQEY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|