C14H12N2O2S — CID 47110700
5-(1,3-benzothiazol-2-yl)-N,N-dimethylfuran-2-carboxamide (PubChem CID 47110700) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N,N-dimethylfuran-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N,N-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 47110700 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N,N-dimethylfuran-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C14H12N2O2S/c1-16(2)14(17)11-8-7-10(18-11)13-15-9-5-3-4-6-12(9)19-13/h3-8H,1-2H3 |
| InChIKey | KVBRDGKLVKJRBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |