C20H16N2O2S — CID 93255813
5-(1,3-benzothiazol-2-yl)-N-[(1R)-1-phenylethyl]furan-2-carboxamide (PubChem CID 93255813) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[(1R)-1-phenylethyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[(1R)-1-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 93255813 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[(1R)-1-phenylethyl]furan-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc(-c2nc3ccccc3s2)o1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2S/c1-13(14-7-3-2-4-8-14)21-19(23)16-11-12-17(24-16)20-22-15-9-5-6-10-18(15)25-20/h2-13H,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | MNMKKOSQRNVYRP-CYBMUJFWSA-N |
| XLogP | 5.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |