C20H13N3O2S — CID 134035305
5-(1,3-benzothiazol-2-yl)-N-[(4-cyanophenyl)methyl]furan-2-carboxamide (PubChem CID 134035305) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[(4-cyanophenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[(4-cyanophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134035305 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[(4-cyanophenyl)methyl]furan-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2ccc(-c3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C20H13N3O2S/c21-11-13-5-7-14(8-6-13)12-22-19(24)16-9-10-17(25-16)20-23-15-3-1-2-4-18(15)26-20/h1-10H,12H2,(H,22,24) |
| InChIKey | PXIVWYSONFKUGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |