C21H17ClN2O3 — CID 25276463
5-(2-chlorophenyl)-N-[4-(cyclopropanecarbonylamino)phenyl]furan-2-carboxamide (PubChem CID 25276463) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[4-(cyclopropanecarbonylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[4-(cyclopropanecarbonylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25276463 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[4-(cyclopropanecarbonylamino)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C2CC2)cc1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C21H17ClN2O3/c22-17-4-2-1-3-16(17)18-11-12-19(27-18)21(26)24-15-9-7-14(8-10-15)23-20(25)13-5-6-13/h1-4,7-13H,5-6H2,(H,23,25)(H,24,26) |
| InChIKey | MTZJMZJZIMBOMW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |