C18H12ClN3O4S — CID 10668776
5-(2-chlorophenyl)-N-[(4-nitrophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 10668776) has the molecular formula C18H12ClN3O4S and a molecular weight of 401.83 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[(4-nitrophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[(4-nitrophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10668776 |
| Molecular Formula | C18H12ClN3O4S |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[(4-nitrophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H12ClN3O4S/c19-14-4-2-1-3-13(14)15-9-10-16(26-15)17(23)21-18(27)20-11-5-7-12(8-6-11)22(24)25/h1-10H,(H2,20,21,23,27) |
| InChIKey | SDECFVVCMXMIRC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|