C17H10Cl2N2O4 — CID 2914733
5-(2,3-dichlorophenyl)-N-(4-nitrophenyl)furan-2-carboxamide (PubChem CID 2914733) has the molecular formula C17H10Cl2N2O4 and a molecular weight of 377.18 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-(4-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-(4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2914733 |
| Molecular Formula | C17H10Cl2N2O4 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-(4-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C17H10Cl2N2O4/c18-13-3-1-2-12(16(13)19)14-8-9-15(25-14)17(22)20-10-4-6-11(7-5-10)21(23)24/h1-9H,(H,20,22) |
| InChIKey | WJSASGKQECCVEY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|