C22H20Cl2N2O2 — CID 5070053
5-(2,3-dichlorophenyl)-N-(4-piperidin-1-ylphenyl)furan-2-carboxamide (PubChem CID 5070053) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-(4-piperidin-1-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-(4-piperidin-1-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5070053 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-(4-piperidin-1-ylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C22H20Cl2N2O2/c23-18-6-4-5-17(21(18)24)19-11-12-20(28-19)22(27)25-15-7-9-16(10-8-15)26-13-2-1-3-14-26/h4-12H,1-3,13-14H2,(H,25,27) |
| InChIKey | WNGUTVCOMPRXJI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|