C27H27Cl2N5O4S — CID 4234447
5-(2,3-dichlorophenyl)-N-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazine-1-carbothioyl]furan-2-carboxamide (PubChem CID 4234447) has the molecular formula C27H27Cl2N5O4S and a molecular weight of 588.52 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazine-1-carbothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazine-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4234447 |
| Molecular Formula | C27H27Cl2N5O4S |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazine-1-carbothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)N1CCN(c2ccc([N+](=O)[O-])c(N3CCCCC3)c2)CC1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C27H27Cl2N5O4S/c28-20-6-4-5-19(25(20)29)23-9-10-24(38-23)26(35)30-27(39)33-15-13-31(14-16-33)18-7-8-21(34(36)37)22(17-18)32-11-2-1-3-12-32/h4-10,17H,1-3,11-16H2,(H,30,35,39) |
| InChIKey | IKSUBIQFECKOBV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|