C23H25Cl2N5O5S — CID 3939411
3,5-dichloro-2-methoxy-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]benzamide (PubChem CID 3939411) has the molecular formula C23H25Cl2N5O5S and a molecular weight of 554.46 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxy-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 3,5-dichloro-2-methoxy-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 3939411 |
| Molecular Formula | C23H25Cl2N5O5S |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 3,5-dichloro-2-methoxy-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]benzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)N1CCN(c2ccc([N+](=O)[O-])c(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C23H25Cl2N5O5S/c1-34-21-17(12-15(24)13-18(21)25)22(31)26-23(36)29-6-4-27(5-7-29)16-2-3-19(30(32)33)20(14-16)28-8-10-35-11-9-28/h2-3,12-14H,4-11H2,1H3,(H,26,31,36) |
| InChIKey | KYMXWWZYXBDNJE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|