C20H20BrClN4O4S — CID 17314197
5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 17314197) has the molecular formula C20H20BrClN4O4S and a molecular weight of 527.83 g/mol. Its IUPAC name is 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17314197 |
| Molecular Formula | C20H20BrClN4O4S |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20BrClN4O4S/c1-12-10-13(21)11-14(18(12)30-2)19(27)23-20(31)25-8-6-24(7-9-25)17-15(22)4-3-5-16(17)26(28)29/h3-5,10-11H,6-9H2,1-2H3,(H,23,27,31) |
| InChIKey | JCQFPOSXISLFOV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|