C18H15Cl3N4O3S — CID 23097126
2,3-dichloro-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]benzamide (PubChem CID 23097126) has the molecular formula C18H15Cl3N4O3S and a molecular weight of 473.77 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 2,3-dichloro-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 23097126 |
| Molecular Formula | C18H15Cl3N4O3S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 2,3-dichloro-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]benzamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H15Cl3N4O3S/c19-12-4-1-3-11(15(12)21)17(26)22-18(29)24-9-7-23(8-10-24)16-13(20)5-2-6-14(16)25(27)28/h1-6H,7-10H2,(H,22,26,29) |
| InChIKey | XWWDJQROJNNXDR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|