C10H11ClN2O3S — CID 163241609
4-(2-chloro-6-nitrophenyl)-1,4-thiazinane 1-oxide (PubChem CID 163241609) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 4-(2-chloro-6-nitrophenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 4-(2-chloro-6-nitrophenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 163241609 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-(2-chloro-6-nitrophenyl)-1,4-thiazinane 1-oxide |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1N1CCS(=O)CC1 |
| InChI | InChI=1S/C10H11ClN2O3S/c11-8-2-1-3-9(13(14)15)10(8)12-4-6-17(16)7-5-12/h1-3H,4-7H2 |
| InChIKey | XSPUZNMPYMJYRQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|