C22H18BrClN4O3S — CID 21168581
5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]naphthalene-1-carboxamide (PubChem CID 21168581) has the molecular formula C22H18BrClN4O3S and a molecular weight of 533.84 g/mol. Its IUPAC name is 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 21168581 |
| Molecular Formula | C22H18BrClN4O3S |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 5-bromo-N-[4-(2-chloro-6-nitrophenyl)piperazine-1-carbothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1)c1cccc2c(Br)cccc12 |
| InChI | InChI=1S/C22H18BrClN4O3S/c23-17-7-2-4-14-15(17)5-1-6-16(14)21(29)25-22(32)27-12-10-26(11-13-27)20-18(24)8-3-9-19(20)28(30)31/h1-9H,10-13H2,(H,25,29,32) |
| InChIKey | CJOFDKGDHWMTKJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|