C18H13ClF4N4O3S — CID 4903290
N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-2-nitrobenzamide (PubChem CID 4903290) has the molecular formula C18H13ClF4N4O3S and a molecular weight of 476.84 g/mol. Its IUPAC name is N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-2-nitrobenzamide.
| Compound Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 4903290 |
| Molecular Formula | C18H13ClF4N4O3S |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-2-nitrobenzamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13ClF4N4O3S/c19-11-12(20)14(22)16(15(23)13(11)21)25-5-7-26(8-6-25)18(31)24-17(28)9-3-1-2-4-10(9)27(29)30/h1-4H,5-8H2,(H,24,28,31) |
| InChIKey | WDYMQPFOTNQNGD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|