C20H18ClF4N3O2S — CID 17334781
N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-ethoxybenzamide (PubChem CID 17334781) has the molecular formula C20H18ClF4N3O2S and a molecular weight of 475.90 g/mol. Its IUPAC name is N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-ethoxybenzamide.
| Compound Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 17334781 |
| Molecular Formula | C20H18ClF4N3O2S |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)N2CCN(c3c(F)c(F)c(Cl)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C20H18ClF4N3O2S/c1-2-30-12-5-3-4-11(10-12)19(29)26-20(31)28-8-6-27(7-9-28)18-16(24)14(22)13(21)15(23)17(18)25/h3-5,10H,2,6-9H2,1H3,(H,26,29,31) |
| InChIKey | GEMSQZJPJSQGKM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|