C20H16ClF4N3OS — CID 17334812
(E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-phenylprop-2-enamide (PubChem CID 17334812) has the molecular formula C20H16ClF4N3OS and a molecular weight of 457.88 g/mol. Its IUPAC name is (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 17334812 |
| Molecular Formula | C20H16ClF4N3OS |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H16ClF4N3OS/c21-14-15(22)17(24)19(18(25)16(14)23)27-8-10-28(11-9-27)20(30)26-13(29)7-6-12-4-2-1-3-5-12/h1-7H,8-11H2,(H,26,29,30)/b7-6+ |
| InChIKey | YAAYEBXIPOXSLO-VOTSOKGWSA-N |
| XLogP | 4.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|