C27H26ClN3OS — CID 17195753
(E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17195753) has the molecular formula C27H26ClN3OS and a molecular weight of 476.05 g/mol. Its IUPAC name is (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17195753 |
| Molecular Formula | C27H26ClN3OS |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H26ClN3OS/c28-24-14-11-21(12-15-24)13-16-25(32)29-27(33)31-19-17-30(18-20-31)26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-16,26H,17-20H2,(H,29,32,33)/b16-13+ |
| InChIKey | PLZABCCNMAAIJO-DTQAZKPQSA-N |
| XLogP | 5.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|