C36H36N4O3S — CID 17227491
(E)-N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 17227491) has the molecular formula C36H36N4O3S and a molecular weight of 604.78 g/mol. Its IUPAC name is (E)-N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17227491 |
| Molecular Formula | C36H36N4O3S |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | (E)-N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(=S)Nc2ccccc2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C36H36N4O3S/c1-2-43-30-20-17-27(18-21-30)19-22-33(41)38-36(44)37-32-16-10-9-15-31(32)35(42)40-25-23-39(24-26-40)34(28-11-5-3-6-12-28)29-13-7-4-8-14-29/h3-22,34H,2,23-26H2,1H3,(H2,37,38,41,44)/b22-19+ |
| InChIKey | GDPKVKBVYAQBOJ-ZBJSNUHESA-N |
| XLogP | 6.16 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|