C22H23FN4O2S — CID 6234935
(E)-3-(4-fluorophenyl)-N-[[2-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 6234935) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[[2-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[[2-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6234935 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[[2-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CN1CCN(C(=O)c2ccccc2NC(=S)NC(=O)/C=C/c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H23FN4O2S/c1-26-12-14-27(15-13-26)21(29)18-4-2-3-5-19(18)24-22(30)25-20(28)11-8-16-6-9-17(23)10-7-16/h2-11H,12-15H2,1H3,(H2,24,25,28,30)/b11-8+ |
| InChIKey | CLSZCOLKPOTHAT-DHZHZOJOSA-N |
| XLogP | 2.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|