C34H33N3O2 — CID 17271699
(E)-N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 17271699) has the molecular formula C34H33N3O2 and a molecular weight of 515.66 g/mol. Its IUPAC name is (E)-N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17271699 |
| Molecular Formula | C34H33N3O2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | (E)-N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C34H33N3O2/c1-26-16-18-27(19-17-26)20-21-32(38)35-31-15-9-8-14-30(31)34(39)37-24-22-36(23-25-37)33(28-10-4-2-5-11-28)29-12-6-3-7-13-29/h2-21,33H,22-25H2,1H3,(H,35,38)/b21-20+ |
| InChIKey | IZWPXKKZKJEDLW-QZQOTICOSA-N |
| XLogP | 6.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|