C25H25N3OS2 — CID 6234997
(E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 6234997) has the molecular formula C25H25N3OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6234997 |
| Molecular Formula | C25H25N3OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (E)-N-(4-benzhydrylpiperazine-1-carbothioyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3OS2/c29-23(14-13-22-12-7-19-31-22)26-25(30)28-17-15-27(16-18-28)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-14,19,24H,15-18H2,(H,26,29,30)/b14-13+ |
| InChIKey | UPTRWUKKPAVJAI-BUHFOSPRSA-N |
| XLogP | 4.57 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|