C31H37N3OS — CID 54782421
N-(4-benzhydrylpiperazine-1-carbothioyl)-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782421) has the molecular formula C31H37N3OS and a molecular weight of 499.72 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazine-1-carbothioyl)-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782421 |
| Molecular Formula | C31H37N3OS |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H37N3OS/c1-23(2)22-25-14-16-26(17-15-25)24(3)30(35)32-31(36)34-20-18-33(19-21-34)29(27-10-6-4-7-11-27)28-12-8-5-9-13-28/h4-17,23-24,29H,18-22H2,1-3H3,(H,32,35,36) |
| InChIKey | MCRDXQZGGGYZSU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|