C30H33N3O3S — CID 4947436
2-phenylethyl 4-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4-oxobutanoate (PubChem CID 4947436) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-phenylethyl 4-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947436 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-phenylethyl 4-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H33N3O3S/c34-27(16-17-28(35)36-23-18-24-10-4-1-5-11-24)31-30(37)33-21-19-32(20-22-33)29(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,29H,16-23H2,(H,31,34,37) |
| InChIKey | JUCUACPRLQQRAG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|