C23H30N2OS — CID 54782467
N-[(2-ethyl-6-methylphenyl)carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782467) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is N-[(2-ethyl-6-methylphenyl)carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[(2-ethyl-6-methylphenyl)carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782467 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[(2-ethyl-6-methylphenyl)carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CCc1cccc(C)c1NC(=S)NC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C23H30N2OS/c1-6-19-9-7-8-16(4)21(19)24-23(27)25-22(26)17(5)20-12-10-18(11-13-20)14-15(2)3/h7-13,15,17H,6,14H2,1-5H3,(H2,24,25,26,27) |
| InChIKey | RKBFDRJYFQAHRW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|