C28H31N3O2S — CID 54782752
N-(3-methylphenyl)-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide (PubChem CID 54782752) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide.
| Compound Name | N-(3-methylphenyl)-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 54782752 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-(3-methylphenyl)-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(NC(=S)NC(=O)C(C)c3ccc(CC(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C28H31N3O2S/c1-18(2)15-21-11-13-22(14-12-21)20(4)26(32)31-28(34)30-25-10-6-8-23(17-25)27(33)29-24-9-5-7-19(3)16-24/h5-14,16-18,20H,15H2,1-4H3,(H,29,33)(H2,30,31,32,34) |
| InChIKey | RBHJJNOOEFJEHN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|