C28H33N3O3S2 — CID 54782501
N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782501) has the molecular formula C28H33N3O3S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782501 |
| Molecular Formula | C28H33N3O3S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)c3ccc(CC(C)C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H33N3O3S2/c1-18(2)16-22-7-9-23(10-8-22)21(5)27(32)30-28(35)29-24-11-13-25(14-12-24)36(33,34)31-26-15-6-19(3)17-20(26)4/h6-15,17-18,21,31H,16H2,1-5H3,(H2,29,30,32,35) |
| InChIKey | WYDQTKRZKPWDQO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|