C27H37N3O3S2 — CID 54782597
N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782597) has the molecular formula C27H37N3O3S2 and a molecular weight of 515.75 g/mol. Its IUPAC name is N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782597 |
| Molecular Formula | C27H37N3O3S2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H37N3O3S2/c1-19(2)18-21-10-12-22(13-11-21)20(3)26(31)29-27(34)28-23-14-16-25(17-15-23)35(32,33)30(4)24-8-6-5-7-9-24/h10-17,19-20,24H,5-9,18H2,1-4H3,(H2,28,29,31,34) |
| InChIKey | FOODLLPSXGINQH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|