C24H30N2O2S — CID 54782363
N-[[3-(2-methylprop-2-enoxy)phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782363) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[[3-(2-methylprop-2-enoxy)phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[[3-(2-methylprop-2-enoxy)phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782363 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[[3-(2-methylprop-2-enoxy)phenyl]carbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | C=C(C)COc1cccc(NC(=S)NC(=O)C(C)c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C24H30N2O2S/c1-16(2)13-19-9-11-20(12-10-19)18(5)23(27)26-24(29)25-21-7-6-8-22(14-21)28-15-17(3)4/h6-12,14,16,18H,3,13,15H2,1-2,4-5H3,(H2,25,26,27,29) |
| InChIKey | BHDKFQFGKNVILI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|