C29H33N3O2S — CID 54782745
N-benzyl-N-methyl-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide (PubChem CID 54782745) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 54782745 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-benzyl-N-methyl-3-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioylamino]benzamide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NC(=S)Nc2cccc(C(=O)N(C)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H33N3O2S/c1-20(2)17-22-13-15-24(16-14-22)21(3)27(33)31-29(35)30-26-12-8-11-25(18-26)28(34)32(4)19-23-9-6-5-7-10-23/h5-16,18,20-21H,17,19H2,1-4H3,(H2,30,31,33,35) |
| InChIKey | IUZYLJDYPPHLKR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|