C24H26N2S — CID 14947206
1-benzhydryl-4-[(E)-3-thiophen-2-ylprop-2-enyl]piperazine (PubChem CID 14947206) has the molecular formula C24H26N2S and a molecular weight of 374.55 g/mol. Its IUPAC name is 1-benzhydryl-4-[(E)-3-thiophen-2-ylprop-2-enyl]piperazine.
| Compound Name | 1-benzhydryl-4-[(E)-3-thiophen-2-ylprop-2-enyl]piperazine |
|---|---|
| PubChem CID | 14947206 |
| Molecular Formula | C24H26N2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-benzhydryl-4-[(E)-3-thiophen-2-ylprop-2-enyl]piperazine |
| SMILES | C(=C/c1cccs1)\CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2S/c1-3-9-21(10-4-1)24(22-11-5-2-6-12-22)26-18-16-25(17-19-26)15-7-13-23-14-8-20-27-23/h1-14,20,24H,15-19H2/b13-7+ |
| InChIKey | IWXCEIJXTDXKTD-NTUHNPAUSA-N |
| XLogP | 5.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |