C24H16Cl3F4N3O2S — CID 17334856
(E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17334856) has the molecular formula C24H16Cl3F4N3O2S and a molecular weight of 592.83 g/mol. Its IUPAC name is (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17334856 |
| Molecular Formula | C24H16Cl3F4N3O2S |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 591.00 |
| IUPAC Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C24H16Cl3F4N3O2S/c25-13-9-12(10-14(26)11-13)16-3-1-15(36-16)2-4-17(35)32-24(37)34-7-5-33(6-8-34)23-21(30)19(28)18(27)20(29)22(23)31/h1-4,9-11H,5-8H2,(H,32,35,37)/b4-2+ |
| InChIKey | JVAZJOBYVZQTLM-DUXPYHPUSA-N |
| XLogP | 6.70 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|