C20H14Cl3F4N3OS — CID 17334813
(E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 17334813) has the molecular formula C20H14Cl3F4N3OS and a molecular weight of 526.77 g/mol. Its IUPAC name is (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17334813 |
| Molecular Formula | C20H14Cl3F4N3OS |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | (E)-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H14Cl3F4N3OS/c21-11-3-1-10(12(22)9-11)2-4-13(31)28-20(32)30-7-5-29(6-8-30)19-17(26)15(24)14(23)16(25)18(19)27/h1-4,9H,5-8H2,(H,28,31,32)/b4-2+ |
| InChIKey | QLOWEXUYANWDKO-DUXPYHPUSA-N |
| XLogP | 5.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|