C22H14Cl3F4N3O2S — CID 17334833
N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17334833) has the molecular formula C22H14Cl3F4N3O2S and a molecular weight of 566.79 g/mol. Its IUPAC name is N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17334833 |
| Molecular Formula | C22H14Cl3F4N3O2S |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 564.98 |
| IUPAC Name | N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C22H14Cl3F4N3O2S/c23-10-1-2-11(12(24)9-10)13-3-4-14(34-13)21(33)30-22(35)32-7-5-31(6-8-32)20-18(28)16(26)15(25)17(27)19(20)29/h1-4,9H,5-8H2,(H,30,33,35) |
| InChIKey | WJVQUNPRBRPHGC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|