C26H25Cl2N5O5S — CID 17314142
5-(2,4-dichlorophenyl)-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]furan-2-carboxamide (PubChem CID 17314142) has the molecular formula C26H25Cl2N5O5S and a molecular weight of 590.49 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17314142 |
| Molecular Formula | C26H25Cl2N5O5S |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[4-(3-morpholin-4-yl-4-nitrophenyl)piperazine-1-carbothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)N1CCN(c2ccc([N+](=O)[O-])c(N3CCOCC3)c2)CC1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C26H25Cl2N5O5S/c27-17-1-3-19(20(28)15-17)23-5-6-24(38-23)25(34)29-26(39)32-9-7-30(8-10-32)18-2-4-21(33(35)36)22(16-18)31-11-13-37-14-12-31/h1-6,15-16H,7-14H2,(H,29,34,39) |
| InChIKey | BRBKXFOIKKCJEP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|