C18H13Cl2F4N3OS — CID 17334762
4-chloro-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]benzamide (PubChem CID 17334762) has the molecular formula C18H13Cl2F4N3OS and a molecular weight of 466.29 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 4-chloro-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 17334762 |
| Molecular Formula | C18H13Cl2F4N3OS |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 4-chloro-N-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazine-1-carbothioyl]benzamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2F4N3OS/c19-10-3-1-9(2-4-10)17(28)25-18(29)27-7-5-26(6-8-27)16-14(23)12(21)11(20)13(22)15(16)24/h1-4H,5-8H2,(H,25,28,29) |
| InChIKey | LDQQPKAVOCXSSJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|