C18H18Cl2N4OS — CID 3608036
N-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioyl]-4-methylbenzamide (PubChem CID 3608036) has the molecular formula C18H18Cl2N4OS and a molecular weight of 409.34 g/mol. Its IUPAC name is N-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioyl]-4-methylbenzamide.
| Compound Name | N-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3608036 |
| Molecular Formula | C18H18Cl2N4OS |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)N2CCN(c3c(Cl)cncc3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H18Cl2N4OS/c1-12-2-4-13(5-3-12)17(25)22-18(26)24-8-6-23(7-9-24)16-14(19)10-21-11-15(16)20/h2-5,10-11H,6-9H2,1H3,(H,22,25,26) |
| InChIKey | MWYHSSVMMREVIP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|